
| CAS: | 61023-66-3 |
| MF: | C11H12Cl2O |
| MW: | 231.12 |
| EINECS: | 606-227-7 |
| Product Categories: | Ketones;61023-66-3 |
| Mol File: | 61023-66-3.mol |
 |
|
| 2',4'-Dichlorovalerophenone Chemical Properties |
| Boiling point | 297.3±20.0 °C(Predicted) |
| density | 1.20 |
| refractive index | 1.5350-1.5390 |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light yellow to Brown |
| InChI | InChI=1S/C11H12Cl2O/c1-2-3-4-11(14)9-6-5-8(12)7-10(9)13/h5-7H,2-4H2,1H3 |
| InChIKey | XVWXSWROOLWNCJ-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(Cl)C=C1Cl)(=O)CCCC |
| CAS DataBase Reference | 61023-66-3(CAS DataBase Reference) |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.