| CAS: | 4498-67-3 |
| MF: | C8H6N2O2 |
| MW: | 162.15 |
| EINECS: | 224-794-5 |
| Product Categories: | Indoles and derivatives;pharmacetical;Acids and Derivatives;Heterocycles;Carboxylic Acids;Organic acids;PHARMACEUTICAL INTERMEDIATES;(intermediate of granisetron);Indazoles;Indole Derivatives;Carboxylic Acids;Fused Ring Systems;Building Blocks;Heterocyclic Building Blocks |
| Mol File: | 4498-67-3.mol |
 |
|
| 7-Hydroxygranisetron Chemical Properties |
| Melting point | 266-270 °C (dec.) |
| Boiling point | 443.7±18.0 °C(Predicted) |
| density | 1.506±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.03±0.10(Predicted) |
| form | powder |
| color | beige |
| BRN | 6354 |
| InChI | InChI=1S/C8H6N2O2/c11-8(12)7-5-3-1-2-4-6(5)9-10-7/h1-4H,(H,9,10)(H,11,12) |
| InChIKey | BHXVYTQDWMQVBI-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(C(O)=O)=N1 |
| CAS DataBase Reference | 4498-67-3(CAS DataBase Reference) |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T，USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.
China
