1. Product information
| Product Name: | alpha-Arbutin |
| Synonyms: | Alpha Arbutin Powder;4-hydroquinone-alpha-d-glucopyranoside;alpha-arbutin;a-Arbutin;Hydroquinone O-α-D-Glucopyranoside;4-Hydroxyphenyl a-D-glucopyranoside;(2R,3S,4S,5R,6S)-2-(HYDROXYMETHYL)-6-(4-HYDROXYPHENOXY)TETRAHYDROPYRAN-3,4,5-TRIOL;4-hydroxyphenyl alpha-D-glucopyranoside |
| CAS: | 84380-01-8 |
| MF: | C12H16O7 |
| MW: | 272.25 |
| EINECS: | 209-795-0 |
| Product Categories: | Plant extract;Aromatics;Carbohydrates & Derivatives;Intermediates & Fine Chemicals;Pharmaceuticals;84380-01-8 |
| Mol File: | 84380-01-8.mol |
 |
|
| alpha-Arbutin Chemical Properties |
| Melting point | 195-196°C |
| Boiling point | 561.6±50.0 °C(Predicted) |
| density | 1.556±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 10.10±0.15(Predicted) |
| color | White to Off-White |
| BRN | 89675 |
| InChI | InChI=1/C12H16O7/c13-5-8-9(15)10(16)11(17)12(19-8)18-7-3-1-6(14)2-4-7/h1-4,8-17H,5H2/t8-,9-,10+,11-,12+/s3 |
| InChIKey | BJRNKVDFDLYUGJ-ZIQFBCGOSA-N |
| SMILES | O(C1C=CC(O)=CC=1)[C@@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O |&1:8,9,10,12,14,r| |
| CAS DataBase Reference | 84380-01-8(CAS DataBase Reference) |
2. Packaging
For powders: normal is 25kgs/Drum or bag, or larger/smaller package as request.
For liquids: normal 25kgs/drum, 180-300kgs/bucket, or IBC, determined by the nature of the product.
Or smaller package 1kg/bottle, 10kgs/bottle as request.
3. Shipping
4. Contact information
For more details, pls contact us freely.
Email address : elin@fdachem.com
Mob: 86 13613820652
WhatsApp/Skype/Wechat/LINE: 86 13613820652
China
