5-hydroxyferulic acid
- Product Name5-hydroxyferulic acid
- CAS1782-55-4
- MFC10H10O5
- MW210.18
- EINECS
- MOL File1782-55-4.mol
Chemical Properties
| Melting point | 168-170 °C |
| Boiling point | 449.1±45.0 °C(Predicted) |
| Density | 1.440±0.06 g/cm3(Predicted) |
| pka | 4.53±0.10(Predicted) |
| form | Solid |
| color | Off-white to light yellow |
| BRN | 2697317 |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C10H10O5/c1-15-8-5-6(2-3-9(12)13)4-7(11)10(8)14/h2-5,11,14H,1H3,(H,12,13)/b3-2+ |
| InChIKey | YFXWTVLDSKSYLW-NSCUHMNNSA-N |
| SMILES | COc1cc(\C=C\C(O)=O)cc(O)c1O |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |