| Melting point |
175-179 °C |
| Boiling point |
509.9±29.0 °C(Predicted) |
| Density |
1.070±0.06 g/cm3(Predicted) |
| storage temp. |
Amber Vial, -20°C Freezer, Under Inert Atmosphere |
| solubility |
Chloroform (Slightly), Methanol (Slightly) |
| form |
Solid |
| pka |
4.73±0.33(Predicted) |
| color |
Yellow to Dark Orange |
| Stability |
Store Dry in Freezer at -20°C for up to 1 year; in Solution at -20°C for up to 3 Months. |
| Major Application |
clinical testing |
| InChI |
InChI=1S/C20H26O3/c1-14(7-6-8-15(2)13-19(22)23)9-10-17-16(3)18(21)11-12-20(17,4)5/h6-10,13H,11-12H2,1-5H3,(H,22,23)/b8-6+,10-9+,14-7+,15-13+ |
| InChIKey |
GGCUJPCCTQNTJF-FRCNGJHJSA-N |
| SMILES |
C(O)(=O)/C=C(/C=C/C=C(/C=C/C1C(C)(C)CCC(=O)C=1C)\C)\C |
