| Melting point |
25-29 °C(lit.) |
| Boiling point |
140-145 |
| alpha |
5.5o (C=20 IN CHLOROFORM) |
| Density |
1.140 g/mL at 20 °C(lit.) |
| refractive index |
n20/D 1.533 |
| Flash point |
>230 °F |
| storage temp. |
2-8°C |
| form |
clear liquid |
| pka |
13.65±0.20(Predicted) |
| color |
Colorless to Light yellow |
| optical activity |
[α]20/D +5.5°, c = 20 in chloroform |
| BRN |
2048922 |
| Stability |
Stable, but moisture sensitive. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C10H14O3/c11-6-10(12)8-13-7-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2/t10-/m1/s1 |
| InChIKey |
LWCIBYRXSHRIAP-SNVBAGLBSA-N |
| SMILES |
C(O)[C@@H](O)COCC1=CC=CC=C1 |
| CAS DataBase Reference |
56552-80-8(CAS DataBase Reference) |
