Chemical Properties
| Melting point | 128-131 °C |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C10H17N4O3.F6P/c1-6-16-9(15)8(7-11)12-17-10(13(2)3)14(4)5;1-7(2,3,4,5)6/h6H2,1-5H3;/q+1;-1/b12-8-; |
| InChIKey | RKTBAMPZUATMIO-JCTPKUEWSA-N |
| SMILES | C(=[N+](/C)\C)(\N(C)C)/O/N=C(/C#N)\C(=O)OCC.[P-](F)(F)(F)(F)(F)F |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 2928.00.5000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
