1-(Tetrahydro-pyran-2-yl)-1H-indazol-6-ylamine
- Product Name1-(Tetrahydro-pyran-2-yl)-1H-indazol-6-ylamine
- CAS1053655-59-6
- MFC12H15N3O
- MW217.27
- EINECS604-604-1
- MOL File1053655-59-6.mol
Chemical Properties
| Boiling point | 428.7±35.0 °C(Predicted) |
| Density | 1.36±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 3.34±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to pink to brown |
| InChI | InChI=1S/C12H15N3O/c13-10-5-4-9-8-14-15(11(9)7-10)12-3-1-2-6-16-12/h4-5,7-8,12H,1-3,6,13H2 |
| InChIKey | BVMGAUOJVUEFSV-UHFFFAOYSA-N |
| SMILES | N1(C2OCCCC2)C2=C(C=CC(N)=C2)C=N1 |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2810 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 29339980 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |