Chemical Properties
| storage temp. | room temp |
| form | liquid |
| color | blue to very dark blue |
| λmax | 423-443 nm |
| Major Application | food and beverages hematology histology || microbiology |
| InChIKey | CNGYZEMWVAWWOB-VAWYXSNFSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC(=NC(=N2)N(CCO)CCO)NC3=CC(=C(C=C3)C=CC4=C(C=C(C=C4)NC5=NC(=NC(=N5)NC6=CC=CC=C6)N(CCO)CCO)S(=O)(=O)O)S(=O)(=O)O |
Safety Information
| Hazard Codes | T |
| Risk Statements | 45-36 |
| Safety Statements | 53-26-45 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1B Eye Irrit. 2 |