1,3-Diiminoisoindoline
- Product Name1,3-Diiminoisoindoline
- CAS57500-34-2
- MFC8H7N3
- MW145.16
- EINECS678-121-9
- MOL File57500-34-2.mol
Chemical Properties
| Melting point | ~197 °C (dec.)(lit.) |
| Boiling point | 240.0±23.0 °C(Predicted) |
| Density | 1.41±0.1 g/cm3(Predicted) |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 6.83±0.20(Predicted) |
| color | Light yellow to Yellow to Green |
| InChI | InChI=1S/C8H7N3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-4H,(H3,9,10,11) |
| InChIKey | RZVCEPSDYHAHLX-UHFFFAOYSA-N |
| SMILES | C1(=N)C2=C(C=CC=C2)C(=N)N1 |
| CAS DataBase Reference | 57500-34-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | NR3500000 |
| F | 3-9-34 |
| HS Code | 2933.99.8290 |
