Chemical Properties
| Melting point | 57° (Barnes, Loder) |
| alpha | D24 -131° (c = 0.96 in ethanol) |
| Boiling point | 330.7±35.0 °C(Predicted) |
| Density | 1.084±0.06 g/cm3(Predicted) |
| RTECS | QJ2850000 |
| storage temp. | -20°C |
| solubility | DMSO: soluble20mg/mL, clear |
| form | powder |
| color | white to beige |
| Stability | Stable for 2 years from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20°C for up to 2 months. |
| InChI | 1S/C15H22O2/c1-14(2)7-4-8-15(3)12(10-17)11(9-16)5-6-13(14)15/h5,9-10,12-13H,4,6-8H2,1-3H3/t12-,13-,15+/m0/s1 |
| InChIKey | AZJUJOFIHHNCSV-KCQAQPDRSA-N |
| SMILES | O=C[C@@H]1[C@@]2([C@H](C(CCC2)(C)C)CC=C1C=O)C |
| LogP | 3.522 (est) |
Safety Information
| Risk Statements | 52/53 |
| Safety Statements | 61 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
