Z-Lys-ONp HCl
- Product NameZ-Lys-ONp HCl
- CAS2179-15-9
- MFC20H24ClN3O6
- MW437.87
- EINECS218-546-5
- MOL File2179-15-9.mol
Chemical Properties
| Melting point | 146-152 °C |
| storage temp. | -20°C |
| solubility | methanol: 50mg/mL, clear, colorless to faintly yellow |
| form | powder |
| color | white to off-white |
| optical activity | [α]20/D 24±1°, c = 1% in DMF |
| BRN | 7191805 |
| Major Application | peptide synthesis |
| InChIKey | JFZLPXVXTZKFDV-FERBBOLQSA-N |
| SMILES | Cl.NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)Oc2ccc(cc2)[N+]([O-])=O |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| Storage Class | 11 - Combustible Solids |