4-Nitrocinnamaldehyde
- Product Name4-Nitrocinnamaldehyde
- CAS49678-08-2
- MFC9H7NO3
- MW177.16
- EINECS626-477-0
- MOL File49678-08-2.mol
Chemical Properties
| Melting point | 140-143 °C(lit.) |
| Boiling point | 311.6±17.0 °C(Predicted) |
| Density | 1.269±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | very faint turbidity in hot EtOH |
| form | powder to crystal |
| color | Light yellow to Brown to Dark green |
| InChI | 1S/C9H7NO3/c11-7-1-2-8-3-5-9(6-4-8)10(12)13/h1-7H/b2-1+ |
| InChIKey | ALGQVMMYDWQDEC-OWOJBTEDSA-N |
| SMILES | [H]C(=O)\C=C\c1ccc(cc1)[N+]([O-])=O |
| CAS DataBase Reference | 49678-08-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | GD6650000 |
| HS Code | 2913000090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |