(1S,2S)-(-)-N-(4-Toluenesulphonyl)-1,2-diaminocyclohexane
- Product Name(1S,2S)-(-)-N-(4-Toluenesulphonyl)-1,2-diaminocyclohexane
- CAS174291-97-5
- MFC13H20N2O2S
- MW268.38
- EINECS
- MOL File174291-97-5.mol
Chemical Properties
| Melting point | 106-110°C |
| Boiling point | 417.4±55.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| pka | 11.69±0.40(Predicted) |
| form | solid |
| Appearance | White to off-white Solid |
| optical activity | [α]/D +26.0 to 34.0°, c = 1 in chloroform |
| InChI | 1S/C13H20N2O2S/c1-10-6-8-11(9-7-10)18(16,17)15-13-5-3-2-4-12(13)14/h6-9,12-13,15H,2-5,14H2,1H3/t12-,13-/m0/s1 |
| InChIKey | VVOFSHARRCJLLA-STQMWFEESA-N |
| SMILES | Cc1ccc(cc1)S(=O)(=O)N[C@H]2CCCC[C@@H]2N |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |