Lidocaine-d10 (N,N-diethyl-d10)
- Product NameLidocaine-d10 (N,N-diethyl-d10)
- CAS851528-09-1
- MFC14H22N2O
- MW234.34
- EINECS
- MOL File851528-09-1.mol
Chemical Properties
| storage temp. | 2-8°C |
| solubility | DMSO: soluble |
| form | Solid |
| color | Off-white to light yellow |
| Major Application | forensics and toxicology |
| InChIKey | NNJVILVZKWQKPM-JKSUIMTKSA-N |
| SMILES | N(C(C([2H])([2H])[2H])([2H])[2H])(C(C([2H])([2H])[2H])([2H])[2H])CC(=O)Nc1c(cccc1C)C |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |