N,N'-Dioctyl-3,4,9,10-perylenedicarboximide
- Product NameN,N'-Dioctyl-3,4,9,10-perylenedicarboximide
- CAS78151-58-3
- MFC40H42N2O4
- MW614.77
- EINECS
- MOL FileMol File
Chemical Properties
| Melting point | >300 °C |
| Boiling point | 775.4±33.0 °C(Predicted) |
| Density | 1.240±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | -2.25±0.20(Predicted) |
| form | powder to crystal |
| color | Orange to Amber to Dark red |
| semiconductor properties | N-type (mobility=1.7cm2/V·s) |
| λmax | 526 nm |
| InChIKey | YFGMQDNQVFJKTR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN1C(=O)c2ccc3c4ccc5C(=O)N(CCCCCCCC)C(=O)c6ccc(c7ccc(C1=O)c2c37)c4c56 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29251900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
