(R)-3,3'-Bis(3,5-bis(trifluoromethyl)pH&
- Product Name(R)-3,3'-Bis(3,5-bis(trifluoromethyl)pH&
- CAS791616-62-1
- MFC36H17F12O4P
- MW772.47
- EINECS
- MOL File791616-62-1.mol
Chemical Properties
| Melting point | 162-175 °C |
| Boiling point | 722.1±70.0 °C(Predicted) |
| Density | 1.63±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Powder |
| pka | 1.09±0.20(Predicted) |
| color | white to light-yellow |
| optical activity | [α]20/D -220°, c = 1 in chloroform (typical) |
| InChIKey | DQORDVSQWPKAQJ-UHFFFAOYSA-N |
| SMILES | O1C2=C(C3=CC(C(F)(F)F)=CC(C(F)(F)F)=C3)C=C3C(=C2C2=C4C(C=CC=C4)=CC(C4=CC(C(F)(F)F)=CC(C(F)(F)F)=C4)=C2OP1(=O)O)C=CC=C3 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
![Synthetic Route of (R)-3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-1,1'-binapthyl-2,2'-diyl hydrogenphosphate](https://img.chemicalbook.com/NewsImg/2020-5-12/202051277889928850.png)