2,4-Pentanedione peroxide
- Product Name2,4-Pentanedione peroxide
- CAS37187-22-7
- MFC10H14O6
- MW230.22
- EINECS253-384-9
- MOL File37187-22-7.mol
Chemical Properties
| Melting point | ≥60 °C (SADT) |
| Boiling point | 68 °C |
| Density | 1.068 g/mL at 25 °C |
| refractive index | n |
| Flash point | 214 °F |
| storage temp. | 2-8°C |
| color | Colorless to light yellow liquid |
| Odor | sharp smell |
| InChI | 1S/C10H14O6/c1-5(11)9(6(2)12)15-16-10(7(3)13)8(4)14/h9-10H,1-4H3 |
| InChIKey | ILENATNBFPBMHG-UHFFFAOYSA-N |
| SMILES | CC(=O)C(OOC(C(C)=O)C(C)=O)C(C)=O |
| EPA Substance Registry System | 2,4-Pentanedione, peroxide (37187-22-7) |
Safety Information
| Hazard Codes | O,C,T |
| Risk Statements | 20/22-34-7-37-61 |
| Safety Statements | 26-36/37/39-45-3/7-14-53 |
| RIDADR | UN 3105 5.2 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HazardClass | 5.2 |
| PackingGroup | II |
| Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials |
| Hazard Classifications | Eye Dam. 1 Org. Perox. D Repr. 1B Skin Corr. 1B STOT SE 3 |