1-Bromo-4-cyclohexylbenzene
- Product Name1-Bromo-4-cyclohexylbenzene
- CAS25109-28-8
- MFC12H15Br
- MW239.15
- EINECS246-623-3
- MOL File25109-28-8.mol
Chemical Properties
| Boiling point | 90-94°C 0,01mm |
| Density | 1,287 g/cm3 |
| refractive index | 1.5595 |
| Flash point | 90-94°C/0.01mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | Not miscible or difficult to mix with water. |
| BRN | 2209869 |
| InChI | InChI=1S/C12H15Br/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10H,1-5H2 |
| InChIKey | LVIJLEREXMVRAN-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(C2CCCCC2)C=C1 |
| CAS DataBase Reference | 25109-28-8(CAS DataBase Reference) |
Safety Information
| Safety Statements | 24/25 |
| HS Code | 29039990 |
