4-(4-Nitrophenyl)morpholine
- Product Name4-(4-Nitrophenyl)morpholine
- CAS10389-51-2
- MFC10H12N2O3
- MW208.21
- EINECS233-851-3
- MOL File10389-51-2.mol
Chemical Properties
| Melting point | 152 °C |
| Boiling point | 386.2±37.0 °C(Predicted) |
| Density | 1.265±0.06 g/cm3(Predicted) |
| RTECS | QE7405000 |
| storage temp. | Storage temp. 2-8°C |
| solubility | soluble in Dimethylformamide |
| form | powder to crystal |
| pka | 0.81±0.40(Predicted) |
| color | Light yellow to Yellow to Orange |
| λmax | 375nm(Dioxane)(lit.) |
| InChI | InChI=1S/C10H12N2O3/c13-12(14)10-3-1-9(2-4-10)11-5-7-15-8-6-11/h1-4H,5-8H2 |
| InChIKey | IAJDSUYFELYZCS-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=C([N+]([O-])=O)C=C2)CCOCC1 |
| CAS DataBase Reference | 10389-51-2(CAS DataBase Reference) |
| EPA Substance Registry System | Morpholine, 4-(4-nitrophenyl)- (10389-51-2) |
Safety Information
| Risk Statements | 40-42/43-63 |
| Safety Statements | 26-36 |
| RIDADR | 1662 |
| TSCA | TSCA listed |
| HS Code | 2934999090 |