5-Acetylsalicylic acid
- Product Name5-Acetylsalicylic acid
- CAS13110-96-8
- MFC9H8O4
- MW180.16
- EINECS236-037-6
- MOL File13110-96-8.mol
Chemical Properties
| Melting point | 214-216°C |
| Boiling point | 413.0±35.0 °C(Predicted) |
| Density | 1.365±0.06 g/cm3(Predicted) |
| Flash point | 250°C |
| storage temp. | 2-8°C |
| solubility | Soluble in DMSO |
| form | powder to crystalline |
| pka | 2.62±0.10(Predicted) |
| color | White to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 2096968 |
| InChI | InChI=1S/C9H8O4/c1-5(10)6-2-3-8(11)7(4-6)9(12)13/h2-4,11H,1H3,(H,12,13) |
| InChIKey | NZRDKNBIPVLNHA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(C(C)=O)=CC=C1O |
| CAS DataBase Reference | 13110-96-8(CAS DataBase Reference) |
