3,6-Dichloro-1,2,4,5-tetrazine
- Product Name3,6-Dichloro-1,2,4,5-tetrazine
- CAS106131-61-7
- MFC2Cl2N4
- MW150.95
- EINECS
- MOL File106131-61-7.mol
Chemical Properties
| Melting point | 148℃ |
| Boiling point | 331.0±25.0 °C(Predicted) |
| Density | 1.750±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| pka | -5.54±0.10(Predicted) |
| color | Orange to red |
| InChI | InChI=1S/C2Cl2N4/c3-1-5-7-2(4)8-6-1 |
| InChIKey | HXXFMIAFWKZHDY-UHFFFAOYSA-N |
| SMILES | N1C(Cl)=NN=C(Cl)N=1 |
| CAS DataBase Reference | 106131-61-7 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Self-react. C Skin Irrit. 2 STOT SE 3 |