ethyl 2-hydroxy-4-methylvalerate
- Product Nameethyl 2-hydroxy-4-methylvalerate
- CAS10348-47-7
- MFC8H16O3
- MW160.21
- EINECS233-760-9
- MOL File10348-47-7.mol
Chemical Properties
| Boiling point | 185 °C |
| Density | 0.97 |
| refractive index | 1.4220 to 1.4260 |
| storage temp. | Storage temp. 2-8°C |
| pka | 13.21±0.20(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Odor | at 100.00 %. fresh blackberry |
| Odor Type | fruity |
| InChI | InChI=1S/C8H16O3/c1-4-11-8(10)7(9)5-6(2)3/h6-7,9H,4-5H2,1-3H3 |
| InChIKey | QRHOWVDPHIXNEN-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(O)CC(C)C |
| LogP | 1.333 (est) |
| CAS DataBase Reference | 10348-47-7 |
Safety Information
| WGK Germany | WGK 3 |
| HS Code | 2918199890 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 Eye Irrit. 2 |