3-(1H-Indol-3-yl)-propan-1-ol
- Product Name3-(1H-Indol-3-yl)-propan-1-ol
- CAS3569-21-9
- MFC11H13NO
- MW175.23
- EINECS222-667-9
- MOL File3569-21-9.mol
Chemical Properties
| Melting point | 0 °C |
| Boiling point | 200 °C / 2mmHg |
| Density | 1,13 g/cm3 |
| refractive index | n20/D1.605 |
| Flash point | >110℃ |
| storage temp. | 2-8°C |
| form | clear liquid to slightly cloudy liquid |
| pka | 15.18±0.10(Predicted) |
| color | White to Yellow to Green |
| InChI | InChI=1S/C11H13NO/c13-7-3-4-9-8-12-11-6-2-1-5-10(9)11/h1-2,5-6,8,12-13H,3-4,7H2 |
| InChIKey | LYPSVQXMCZIRGP-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(CCCO)=C1 |
| CAS DataBase Reference | 3569-21-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 10 - Combustible liquids |
