4-Benzoylphenyl Methacrylate
- Product Name4-Benzoylphenyl Methacrylate
- CAS56467-43-7
- MFC17H14O3
- MW266.29
- EINECS611-390-2
- MOL File56467-43-7.mol
Chemical Properties
| Melting point | 63 °C |
| Boiling point | 418.2±24.0 °C(Predicted) |
| Density | 1.142±0.06 g/cm3(Predicted) |
| vapor pressure | 0.006Pa at 25℃ |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | soluble in Toluene |
| form | Solid |
| color | White to Light yellow |
| InChI | InChI=1S/C17H14O3/c1-12(2)17(19)20-15-10-8-14(9-11-15)16(18)13-6-4-3-5-7-13/h3-11H,1H2,2H3 |
| InChIKey | RYWGNBFHIFRNEP-UHFFFAOYSA-N |
| SMILES | C(OC1=CC=C(C(=O)C2=CC=CC=C2)C=C1)(=O)C(C)=C |
| LogP | 3.6 at 25℃ and pH7 |