| Melting point |
209-2130C (dec) |
| Density |
1.4737 (rough estimate) |
| refractive index |
1.6390 (estimate) |
| storage temp. |
2-8°C |
| solubility |
Practically insoluble in water, sparingly soluble in methylene chloride, very slightly soluble in anhydrous ethanol. It dissolves in solutions of acids and alkalis. |
| pka |
pKa1 5.3, pKa2 1.1(at 25℃) |
| form |
Solid |
| color |
White to Yellow to Green |
| Water Solubility |
61.9mg/L(32 ºC) |
| Major Application |
pharmaceutical
pharmaceutical small molecule |
| InChI |
InChI=1S/C13H11N3O4S2/c1-16-10(13(18)15-9-4-2-3-6-14-9)11(17)12-8(5-7-21-12)22(16,19)20/h2-7,17H,1H3,(H,14,15,18) |
| InChIKey |
LZNWYQJJBLGYLT-UHFFFAOYSA-N |
| SMILES |
S1(=O)(=O)C2C=CSC=2C(O)=C(C(NC2=NC=CC=C2)=O)N1C |
| CAS DataBase Reference |
59804-37-4 |
