| Melting point |
140-147°C |
| Boiling point |
77℃ |
| Flash point |
>110°(230°F) |
| storage temp. |
Keep in dark place,Inert atmosphere,2-8°C |
| solubility |
H2O: 50 mg/mL, clear, colorless |
| form |
powder |
| color |
white |
| optical activity |
[α]/D 144±4°, c = 0.1 in H2O |
| Water Solubility |
Soluble in water.Soluble in water and methanol. |
| Stability |
Hygroscopic |
| Major Application |
forensics and toxicology pharmaceutical (small molecule) |
| InChI |
InChI=1/C10H12N4O5S.Na.H/c1-10(5-13-3-2-11-12-13)8(9(16)17)14-6(15)4-7(14)20(10,18)19;;/h2-3,7-8H,4-5H2,1H3,(H,16,17);;/t7-,8+,10+;;/s3 |
| InChIKey |
AZZGLBOEYUNRAU-PPTWGLPTNA-N |
| SMILES |
C(N1N=NC=C1)[C@@]1(S([C@]2([H])CC(=O)N2[C@H]1C(=O)O)(=O)=O)C.[NaH] |&1:6,8,14,r| |
| CAS DataBase Reference |
89785-84-2(CAS DataBase Reference) |