| Melting point |
245-246° (dec) |
| alpha |
D25 -6.81° (c = 0.665 in 0.1 M HCl) |
| storage temp. |
-20°C |
| solubility |
water, oxygen free: soluble19.60 - 20.40mg/mL, clear to slightly hazy, colorless to faintly yellow |
| form |
White to off-white powder. |
| color |
White to off-white |
| Water Solubility |
water, oxygen free: soluble 19.60-20.40mg/mL, clear to slightly hazy, colorless to faintly yellow |
| Stability |
Hygroscopic |
| InChI |
InChI=1/C9H15N5O3.2ClH/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7;;/h3-4,6,12,15-16H,2H2,1H3,(H4,10,11,13,14,17);2*1H/t3-,4+,6-;;/s3 |
| InChIKey |
RKSUYBCOVNCALL-WDROUVJUNA-N |
| SMILES |
C12NC(N)=NC(=O)C=1N[C@]([H])(CN2)[C@@H](O)[C@@H](O)C.Cl.Cl |&1:9,13,15,r| |
| CAS DataBase Reference |
69056-38-8(CAS DataBase Reference) |
