| Melting point |
83-85°C |
| alpha |
D -54.84° (c = 1 in methanol); D20 -39.8° (c = 0.5 in water) |
| Boiling point |
565.3±50.0 °C(Predicted) |
| Density |
1.133±0.06 g/cm3(Predicted) |
| storage temp. |
Keep in dark place,Sealed in dry,2-8°C |
| solubility |
Chloroform (Sparingly), Ethanol (Sparingly), Ethyl Acetate (Sparingly), Methanol |
| pka |
pKa1 3.01; pKa2 8.02(at 25℃) |
| form |
Solid |
| color |
White to Off-White |
| optical activity |
[α]/D -41.0±3.0°, c = 0.5 in H2O |
| BRN |
8352678 |
| Henry's Law Constant |
4.3×103 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability |
Hygroscopic |
| Major Application |
cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions |
FLAVOURING |
| InChI |
InChI=1/C20H30N2O5/c1-20(2,3)10-11-21-15(13-17(23)24)18(25)22-16(19(26)27-4)12-14-8-6-5-7-9-14/h5-9,15-16,21H,10-13H2,1-4H3,(H,22,25)(H,23,24)/t15-,16-/s3 |
| InChIKey |
HLIAVLHNDJUHFG-HOTGVXAUSA-N |
| SMILES |
C(=O)([C@@H](NCCC(C)(C)C)CC(O)=O)N[C@@H](CC1=CC=CC=C1)C(OC)=O |&1:2,15,r| |
| LogP |
3.834 (est) |