| Melting point |
121-1230C |
| Boiling point |
225°C/1.5mmHg(lit.) |
| Density |
1.1514 (rough estimate) |
| refractive index |
1.5200 (estimate) |
| Flash point |
9 °C |
| storage temp. |
Sealed in dry,Store in freezer, under -20°C |
| solubility |
DMSO: ≥2mg/mL (warmed to 60 °C) |
| form |
powder |
| pka |
12.26±0.40(Predicted) |
| color |
white to tan |
| BCS Class |
2 |
| InChI |
1S/C12H15NO3/c1-8-3-9(2)5-10(4-8)15-7-11-6-13-12(14)16-11/h3-5,11H,6-7H2,1-2H3,(H,13,14) |
| InChIKey |
IMWZZHHPURKASS-UHFFFAOYSA-N |
| SMILES |
Cc1cc(C)cc(OCC2CNC(=O)O2)c1 |
| CAS DataBase Reference |
1665-48-1(CAS DataBase Reference) |
| NIST Chemistry Reference |
Metaxalone(1665-48-1) |
| EPA Substance Registry System |
2-Oxazolidinone, 5-[(3,5-dimethylphenoxy)methyl]- (1665-48-1) |
