| Melting point |
199~201℃ |
| Boiling point |
386.6±27.0 °C(Predicted) |
| Density |
1.415±0.06 g/cm3(Predicted) |
| storage temp. |
under inert gas (nitrogen or Argon) at 2-8°C |
| form |
powder to crystal |
| pka |
pK1:2.72(＋1);pK2:9.25(0) (25°C,μ=0.16) |
| color |
White to Almost white |
| optical activity |
Consistent with structure |
| Water Solubility |
Slightly soluble in water. |
| Sensitive |
Moisture Sensitive |
| InChI |
InChI=1S/C3H7NO3/c4-1-2(5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1 |
| InChIKey |
BMYNFMYTOJXKLE-REOHCLBHSA-N |
| SMILES |
C(O)(=O)[C@@H](O)CN |
| CAS DataBase Reference |
632-13-3(CAS DataBase Reference) |
