| Melting point |
160 °C (dec.)(lit.) |
| vapor pressure |
2.6 mm Hg ( 20 °C) |
| storage temp. |
2-8°C |
| solubility |
H2O: 1 M hot, clear, colorless |
| Colour Index |
11050 |
| form |
Powder |
| color |
≤10(APHA) |
| Water Solubility |
Soluble in water (20 mg/ml at 20°C), ethanol, and slightly soluble in alcohol. |
| λmax |
660nm, 395nm |
| ε(extinction coefficient) |
≥28000 at 651-677nm in ethanol: water (1:1) at 0.01g/L |
| Merck |
14,5255 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Biological Applications |
Antimalarialagents; diagnosis of diseases related to amyloid accumulation; diagnostic assays; detecting fungi; nucleic acids; sugars |
| Major Application |
diagnostic assay manufacturing
hematology
histology |
| InChIKey |
XXACTDWGHQXLGW-UHFFFAOYSA-M |
| SMILES |
[Cl-].CCN(CC)c1ccc2nc3ccc(cc3[n+](-c4ccccc4)c2c1)\N=N\c5ccc(cc5)N(C)C |
| CAS DataBase Reference |
2869-83-2(CAS DataBase Reference) |
| EPA Substance Registry System |
Phenazinium, 3-(diethylamino)-7-[[4-(dimethylamino)phenyl]azo]-5-phenyl-, chloride (2869-83-2) |
