| Melting point |
110-116°C |
| Boiling point |
548.6±43.0 °C(Predicted) |
| Density |
1.328±0.06 g/cm3(Predicted) |
| refractive index |
32 ° (C=1, DMF) |
| storage temp. |
2-8°C |
| solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form |
powder to crystal |
| pka |
3.95±0.20(Predicted) |
| color |
White to Light yellow |
| optical activity |
[α]/D +31.0±3.0°, c = 1 in DMF |
| BRN |
5856698 |
| Major Application |
peptide synthesis |
| InChI |
InChI=1S/C20H19NO4/c22-19(23)18-10-5-11-21(18)20(24)25-12-17-15-8-3-1-6-13(15)14-7-2-4-9-16(14)17/h1-4,6-9,17-18H,5,10-12H2,(H,22,23)/t18-/m1/s1 |
| InChIKey |
ZPGDWQNBZYOZTI-GOSISDBHSA-N |
| SMILES |
N1(C(OCC2C3=C(C=CC=C3)C3=C2C=CC=C3)=O)CCC[C@@H]1C(O)=O |
| CAS DataBase Reference |
101555-62-8(CAS DataBase Reference) |