| Melting point |
155°C |
| Boiling point |
559.8±33.0 °C(Predicted) |
| Density |
1?+-.0.06 g/cm3(Predicted) |
| refractive index |
25 ° (C=1, DMF) |
| storage temp. |
2-8°C |
| solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form |
powder to crystal |
| pka |
3.91±0.21(Predicted) |
| color |
White to Almost white |
| optical activity |
Consistent with structure |
| Water Solubility |
Insoluble in water. |
| Major Application |
peptide synthesis |
| InChI |
InChI=1S/C21H23NO4/c1-13(2)11-19(20(23)24)22-21(25)26-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18-19H,11-12H2,1-2H3,(H,22,25)(H,23,24)/t19-/m1/s1 |
| InChIKey |
CBPJQFCAFFNICX-LJQANCHMSA-N |
| SMILES |
C(O)(=O)[C@@H](CC(C)C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference |
114360-54-2(CAS DataBase Reference) |