| Melting point |
-25℃ |
| Boiling point |
380 °C |
| Density |
0.980 g/mL at 20 °C(lit.) |
| vapor pressure |
5(x 10-8 mmHg) at 82 °C, 500 at 132 °C (Gross and Colony, 1973) |
| refractive index |
n20/D 1.485 |
| Flash point |
219 °C |
| storage temp. |
2-8°C |
| solubility |
Chloroform (Slightly), Methanol (Slightly) |
| form |
Oily Liquid |
| Specific Gravity |
0.98 |
| color |
Colourless |
| Water Solubility |
Insoluble in water. |
| Merck |
14,2864 |
| BRN |
1915994 |
| Henry's Law Constant |
1.41(x 10-12 atmm3/mol) at 25 °C (approximate - calculated from water solubility and vapor pressure) |
| Dielectric constant |
5.1(24℃) |
| Major Application |
cleaning products cosmetics food and beverages personal care |
| InChI |
1S/C24H38O4/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3 |
| InChIKey |
MQIUGAXCHLFZKX-UHFFFAOYSA-N |
| SMILES |
CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC |
| CAS DataBase Reference |
117-84-0(CAS DataBase Reference) |
| NIST Chemistry Reference |
Di-n-octyl phthalate(117-84-0) |
| EPA Substance Registry System |
Di-n-octyl phthalate (117-84-0) |