| Melting point |
183 °C |
| Boiling point |
418.73°C (rough estimate) |
| Density |
0.93 |
| vapor density |
13 (vs air) |
| refractive index |
1.4155-1.4175 |
| Flash point |
208.9±23.6 °C |
| storage temp. |
2-8°C |
| solubility |
ethanol: 10 mg/mL |
| form |
powder |
| pka |
8.09(at 25℃) |
| Colour Index |
75300 |
| color |
orange |
| Odor |
Odorless |
| PH Range |
Yellow (7.8) to red-brown (9.2) |
| biological source |
Curcuma longa (Turmeric) |
| Water Solubility |
Slightly soluble (hot) |
| λmax |
430nm |
| Merck |
14,2673 |
| Solvent |
Ethanol |
| Concentration |
1 mCi/ml |
| Specific Activity |
5-15 Ci/mmol |
| BRN |
2306965 |
| Henry's Law Constant |
1.4×1016 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability |
Stable, but may be light sensitive. Incompatible with strong oxidizing agents. |
| Major Application |
Cosmetics, drug-eluting stents, inhibition of formation of skin-wrinkles, treating alzheimer’s disease, skin diseases, coronary restenosis, diabetes, obesity, leukemia, neurofibromas, cancer, antimicrobial, antiviral, antiinflammatory, antiprostate cancer |
| Cosmetics Ingredients Functions |
ANTIOXIDANT COLORANT |
| InChI |
1S/C21H20O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3-12,24-25H,13H2,1-2H3/b7-3+,8-4+ |
| InChIKey |
VFLDPWHFBUODDF-FCXRPNKRSA-N |
| SMILES |
COc1cc(\C=C\C(=O)CC(=O)\C=C\c2ccc(O)c(OC)c2)ccc1O |
| LogP |
3.290 (est) |
| CAS DataBase Reference |
458-37-7(CAS DataBase Reference) |
| EPA Substance Registry System |
Curcumin (458-37-7) |