| Melting point |
39-42 °C(lit.) |
| Boiling point |
260-262 °C(lit.) |
| Density |
1.038 |
| vapor pressure |
0.01 mm Hg ( 25 °C) |
| FEMA |
2881 | 4-PHENYL-3-BUTEN-2-ONE |
| refractive index |
1.5836 |
| Flash point |
150 °F |
| storage temp. |
Store at <= 20°C. |
| solubility |
Soluble in alcohol, chloroform, diethyl ether. |
| form |
Low Melting Solid |
| color |
Pale yellow to yellow |
| Odor |
Sweet, but rather pungent odor with a creamy-floral note. |
| biological source |
synthetic |
| Odor Type |
spicy |
| Water Solubility |
1.398g/L(25 ºC) |
| Sensitive |
Light Sensitive |
| Merck |
14,1137 |
| JECFA Number |
820 |
| BRN |
742046 |
| Stability |
Light Sensitive |
| InChI |
1S/C10H10O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-8H,1H3/b8-7+ |
| InChIKey |
BWHOZHOGCMHOBV-BQYQJAHWSA-N |
| SMILES |
[H]\C(=C(\[H])c1ccccc1)C(C)=O |
| LogP |
2.04 |
| CAS DataBase Reference |
122-57-6(CAS DataBase Reference) |
| NIST Chemistry Reference |
3-Buten-2-one, 4-phenyl-(122-57-6) |
| EPA Substance Registry System |
Benzylideneacetone (122-57-6) |