| Melting point |
103-107 °C (lit.) |
| Boiling point |
312 °C (lit.) |
| Density |
0.88 g/mL at 25 °C (lit.) |
| refractive index |
1.6415 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
powder to crystal |
| color |
White to Almost white |
| Water Solubility |
1.332mg/L(24.59 ºC) |
| BRN |
1364575 |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C14H12/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-8H,9-10H2 |
| InChIKey |
WPDAVTSOEQEGMS-UHFFFAOYSA-N |
| SMILES |
C1=C2C(CC3=C(C2)C=CC=C3)=CC=C1 |
| CAS DataBase Reference |
613-31-0(CAS DataBase Reference) |
| EPA Substance Registry System |
Anthracene, 9,10-dihydro- (613-31-0) |