| Melting point |
130.5-135.5 °C(lit.) |
| Boiling point |
510.36°C (rough estimate) |
| alpha |
25 º (c=1,EtOAc 24 ºC) |
| Density |
1.2369 (rough estimate) |
| refractive index |
24 ° (C=1, AcOEt) |
| storage temp. |
2-8°C |
| solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form |
powder to crystal |
| pka |
3.44±0.10(Predicted) |
| color |
White to Almost white |
| optical activity |
[α]20/D +25.5±1°, c = 1% in ethyl acetate |
| BRN |
3632013 |
| InChI |
InChI=1S/C22H25NO5/c1-22(2,3)28-13-19(20(24)25)23-21(26)27-12-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18-19H,12-13H2,1-3H3,(H,23,26)(H,24,25)/t19-/m0/s1 |
| InChIKey |
REITVGIIZHFVGU-IBGZPJMESA-N |
| SMILES |
C(O)(=O)[C@H](COC(C)(C)C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference |
71989-33-8(CAS DataBase Reference) |