| Density |
1.03 |
| Flash point |
272℃ |
| storage temp. |
Refrigerator |
| solubility |
Very soluble in water, soluble in ethanol (96 per cent), insoluble in liquid paraffin. It solidifies at about 25 °C. |
| form |
Solid |
| color |
Clear Colourless Oil to Off-White |
| Odor |
magnolia white flower fresh citrus natural |
| PH |
5.0-7.0 (1g/10 mL in H2O) |
| Major Application |
pharmaceutical (small molecule) |
| InChI |
InChI=1S/C18H36O3.C2H6O2/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;3-1-2-4/h17,19H,2-16H2,1H3,(H,20,21);3-4H,1-2H2 |
| InChIKey |
DDBOXFRAKNHBIX-UHFFFAOYSA-N |
| SMILES |
OC{-}CO{+n}[H].C(O)(CCCCCC)CCCCCCCCCCC(=O)O |
| EPA Substance Registry System |
Octadecanoic acid, 12-hydroxy-, polymer with .alpha.-hydro-.omega.-hydroxypoly(oxy-1,2-ethanediyl) (70142-34-6) |
