| storage temp. |
2-8°C |
| solubility |
0.1 M HCl: 10 mg/ml; DMSO: 10 mg/ml |
| form |
A crystalline solid |
| color |
White to light yellow |
| PH |
7.3 |
| biological source |
synthetic |
| Water Solubility |
water: 50mg/mL, clear to hazy, colorless to faintly yellow |
| λmax |
257 (pH 3);258,281 (pH 7);282 (pH 9) |
| BRN |
3713683 |
| Stability |
Hygroscopic |
| InChI |
InChI=1/C11H17N5O5/c1-15-3-16(8-5(15)9(20)14-11(12)13-8)10-7(19)6(18)4(2-17)21-10/h4,6-7,10,17-19H,2-3H2,1H3,(H3,12,13,14,20)/t4-,6-,7-,10-/s3 |
| InChIKey |
OGHAROSJZRTIOK-KQYNXXCUSA-N |
| SMILES |
OC[C@H]1O[C@@H](N2C3=C(C(NC(=N3)N)=O)N(C)C2)[C@H](O)[C@@H]1O |&1:2,4,17,19,r| |