| Melting point |
180°C(dec.)(lit.) |
| Boiling point |
537.1±45.0 °C(Predicted) |
| Density |
1?+-.0.06 g/cm3(Predicted) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
soluble in Dimethylformamide |
| form |
powder to crystal |
| pka |
3.27±0.36(Predicted) |
| color |
White to Light yellow to Light red |
| InChI |
InChI=1S/C18H19NO4/c1-3-19(4-2)12-9-10-15(16(20)11-12)17(21)13-7-5-6-8-14(13)18(22)23/h5-11,20H,3-4H2,1-2H3,(H,22,23) |
| InChIKey |
FQNKTJPBXAZUGC-UHFFFAOYSA-N |
| SMILES |
C(O)(=O)C1=CC=CC=C1C(=O)C1=CC=C(N(CC)CC)C=C1O |
| CAS DataBase Reference |
5809-23-4(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzoic acid, 2-[4-(diethylamino)-2-hydroxybenzoyl]- (5809-23-4) |
