| Boiling point |
235-236 °C(lit.) |
| Density |
0.927 g/mL at 25 °C(lit.) |
| refractive index |
1.52-1.522 |
| Flash point |
225 °F |
| storage temp. |
Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| pka |
9.24±0.10(Predicted) |
| form |
Liquid |
| Specific Gravity |
0.93 |
| color |
Clear pale yellow |
| Water Solubility |
Not miscible or difficult to mix with water. |
| Sensitive |
Air Sensitive |
| BRN |
2961797 |
| InChI |
InChI=1S/C11H17N/c1-11(2,3)10-6-4-9(8-12)5-7-10/h4-7H,8,12H2,1-3H3 |
| InChIKey |
MPWSRGAWRAYBJK-UHFFFAOYSA-N |
| SMILES |
C1(CN)=CC=C(C(C)(C)C)C=C1 |
| CAS DataBase Reference |
39895-55-1(CAS DataBase Reference) |
