| Melting point |
127-128°C |
| Boiling point |
334.29°C (rough estimate) |
| Density |
1.3145 (rough estimate) |
| vapor pressure |
0Pa at 20℃ |
| refractive index |
1.7400 (estimate) |
| storage temp. |
2-8°C, protect from light |
| pka |
14.60±0.10(Predicted) |
| form |
powder to crystal |
| color |
Amber to Dark green to Black |
| Water Solubility |
<0.01 g/100 mL at 18 ºC |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions |
HAIR DYEING |
| Cosmetic Ingredient Review (CIR) |
2-(4-Amino-2-nitroanilino)-ethanol (2871-01-4) |
| InChI |
InChI=1S/C8H11N3O3/c9-6-1-2-7(10-3-4-12)8(5-6)11(13)14/h1-2,5,10,12H,3-4,9H2 |
| InChIKey |
GZGZVOLBULPDFD-UHFFFAOYSA-N |
| SMILES |
C(O)CNC1=CC=C(N)C=C1[N+]([O-])=O |
| LogP |
0.27 at 20℃ |
| CAS DataBase Reference |
2871-01-4(CAS DataBase Reference) |
| IARC |
3 (Vol. 57) 1993 |
| EPA Substance Registry System |
HC Red No. 3 (2871-01-4) |
