| Melting point |
76-78 °C(lit.) |
| Boiling point |
202 °C(lit.) |
| Density |
1.23 |
| refractive index |
n20/D 1.55(lit.) |
| Flash point |
>230 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Chloroform, Ethyl Acetate |
| form |
Solid |
| color |
Brown |
| Water Solubility |
Insoluble |
| FreezingPoint |
24.0 to 28.0 ℃ |
| BRN |
1102322 |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI |
1S/C8H7NO3/c1-6(10)7-4-2-3-5-8(7)9(11)12/h2-5H,1H3 |
| InChIKey |
SUGXZLKUDLDTKX-UHFFFAOYSA-N |
| SMILES |
CC(=O)c1ccccc1[N+]([O-])=O |
| CAS DataBase Reference |
577-59-3(CAS DataBase Reference) |
| NIST Chemistry Reference |
Ethanone, 1-(2-nitrophenyl)-(577-59-3) |
| EPA Substance Registry System |
2-Nitroacetophenone (577-59-3) |
