| Melting point |
148-149 °C |
| Density |
1.12 g/mL at 20 °C (lit.) |
| vapor pressure |
1.2Pa at 20℃ |
| storage temp. |
Store at RT. |
| solubility |
DMSO (Soluble), Water (Soluble) |
| form |
Colourless Solution |
| color |
Colorless to light yellow |
| Water Solubility |
>=10 g/100 mL at 20 ºC |
| BRN |
5177087 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C8H18O4S.Na/c1-3-5-6-8(4-2)7-12-13(9,10)11;/h8H,3-7H2,1-2H3,(H,9,10,11);/q;+1/p-1 |
| InChIKey |
DGSDBJMBHCQYGN-UHFFFAOYSA-M |
| SMILES |
C(CC)(CCCC)COS([O-])(=O)=O.[Na+] |
| LogP |
-0.248 at 25℃ |
| CAS DataBase Reference |
126-92-1(CAS DataBase Reference) |
| EPA Substance Registry System |
Sodium ethasulfate (126-92-1) |
