| Melting point |
50 °C |
| Boiling point |
286.4±29.0 °C(Predicted) |
| Density |
1.04±0.1 g/cm3(Predicted) |
| refractive index |
20 ° (C=1, EtOH) |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| form |
powder to crystal |
| pka |
12.37±0.20(Predicted) |
| color |
White to Light yellow to Light orange |
| optical activity |
[α]/D +21.5±1.5°, c = 1 in ethanol |
| Water Solubility |
Soluble in water. |
| Sensitive |
Air Sensitive |
| BRN |
5377812 |
| InChI |
InChI=1S/C9H18N2O2/c1-9(2,3)13-8(12)11-7-4-5-10-6-7/h7,10H,4-6H2,1-3H3,(H,11,12)/t7-/m1/s1 |
| InChIKey |
DQQJBEAXSOOCPG-SSDOTTSWSA-N |
| SMILES |
C(OC(C)(C)C)(=O)N[C@@H]1CCNC1 |
| CAS DataBase Reference |
122536-77-0(CAS DataBase Reference) |