| Melting point |
154-156°C |
| Boiling point |
385.1°C (rough estimate) |
| Density |
1.1338 (rough estimate) |
| vapor pressure |
0-0Pa at 25℃ |
| refractive index |
1.6419 (estimate) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
DMSO (Slightly), Methanol (Slightly) |
| form |
Solid |
| pka |
13.44±0.70(Predicted) |
| color |
White to Off-White |
| InChI |
InChI=1S/C14H14N2O2/c1-18-13-8-7-10(9-12(13)15)14(17)16-11-5-3-2-4-6-11/h2-9H,15H2,1H3,(H,16,17) |
| InChIKey |
LHMQDVIHBXWNII-UHFFFAOYSA-N |
| SMILES |
C(NC1=CC=CC=C1)(=O)C1=CC=C(OC)C(N)=C1 |
| LogP |
2.08 at 23℃ and pH7 |
| CAS DataBase Reference |
120-35-4(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzamide, 3-amino-4-methoxy-N-phenyl- (120-35-4) |