| Boiling point |
115°C/20mmHg(lit.) |
| Density |
0.832 g/cm3(Temp: 19 °C) |
| refractive index |
1.4160 to 1.4200 |
| solubility |
Practically insoluble in water, soluble in alcohol and oils |
| form |
clear liquid |
| color |
Colorless to Almost colorless |
| Odor |
at 100.00 %. green citrus oily fatty woody spicy fruity |
| Odor Type |
green |
| InChI |
InChI=1S/C12H26O2/c1-4-7-8-9-10-11-12(13-5-2)14-6-3/h12H,4-11H2,1-3H3 |
| InChIKey |
BRKIPAWFUDCCOO-UHFFFAOYSA-N |
| SMILES |
C(OCC)(OCC)CCCCCCC |
| LogP |
4.079 (est) |
| CAS DataBase Reference |
54889-48-4 |
| NIST Chemistry Reference |
Octane, 1,1-diethoxy-(54889-48-4) |
| EPA Substance Registry System |
Octane, 1,1-diethoxy- (54889-48-4) |
