
Ethyl 4-nitrobenzoylacetate
한글명:Ethyl 4-nitrobenzoylacetate
카스 번호838-57-3
상품명:Ethyl 4-nitrobenzoylacetate
CBNumberCB8756127
분자식C11H11NO5
포뮬러 무게237.21
MOL 파일838-57-3.mol
화학적 성질
녹는점 | 67-71 °C |
끓는 점 | 379.74°C (rough estimate) |
밀도 | 1.3350 (rough estimate) |
굴절률 | 1.5300 (estimate) |
저장 조건 | Sealed in dry,Room Temperature |
산도 계수 (pKa) | 8.70±0.25(Predicted) |
물리적 상태 | powder to crystal |
색상 | White to Light yellow to Light orange |
BRN | 1124763 |
InChI | InChI=1S/C11H11NO5/c1-2-17-11(14)7-10(13)8-3-5-9(6-4-8)12(15)16/h3-6H,2,7H2,1H3 |
InChIKey | NGRXSVFCLHVGKU-UHFFFAOYSA-N |
SMILES | C1(C=CC([N+]([O-])=O)=CC=1)C(=O)CC(=O)OCC |
CAS 데이터베이스 | 838-57-3(CAS DataBase Reference) |
EPA | Benzenepropanoic acid, 4-nitro-.beta.-oxo-, ethyl ester (838-57-3) |
위험품 표기 | Xi | |||||||||
위험 카페고리 넘버 | 36/37/38 | |||||||||
안전지침서 | 24/25-36/37-26 | |||||||||
WGK 독일 | 2 | |||||||||
RTECS 번호 | AJ1073500 | |||||||||
TSCA | Yes | |||||||||
위험 등급 | IRRITANT | |||||||||
HS 번호 | 29183000 | |||||||||
NFPA 704: |
|